Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Name: Diethyl 2-propyl-1H-imidazole-4,5-dicarboxylate, 144689-94-1, Name is Diethyl 2-propyl-1H-imidazole-4,5-dicarboxylate, SMILES is O=C(C1=C(C(OCC)=O)NC(CCC)=N1)OCC, belongs to imidazoles-derivatives compound. In a document, author is Haddadzadeh, Elham, introduce the new discover.
One-pot Synthesize of Phenyl Phenanthro Imidazole Derivatives Catalyzed by Lewis Acid in the Presence of Ammonium Acetate
Tri substituted imidazole derivatives were synthesized with the combinations of phenanthroquinone, benzealdehyde derivatives at the presence of ammonium acetate that catalyzed by Lewis acid. In all reactions, polar solvent was used and the reactions were carried out under the reflux conditions. The structure of all compounds was confirmed using the IR and (HNMR)-H-1. This method revealed several advantages including, excellent yields, simplicity of operation and easy separation. The results showed that, products formed in high yields and low reaction times. Also, the metal atom of Lewis acid catalyst increased the reactivity of substrate and the reaction time. Copyright (C) 2020 by SPC (Sami Publishing Company)
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 144689-94-1 is helpful to your research. Name: Diethyl 2-propyl-1H-imidazole-4,5-dicarboxylate.