Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 38668-46-1, Name is 6-(2-(2-Methyl-1H-imidazol-1-yl)ethyl)-1,3,5-triazine-2,4-diamine, SMILES is CC1=NC=CN1CCC2=NC(N)=NC(N)=N2, belongs to imidazoles-derivatives compound. In a document, author is Yuan, Ruijuan, introduce the new discover, COA of Formula: C9H13N7.
Synthesis of chiral SalenZn(II) and its coordination with imidazole derivatives and amino acid ester derivatives
A chiral complex, SalenZn(II) ( S), was synthesized and characterized. Its coordination with imidazole derivatives and amino acid ester derivatives was studied by UV-vis spectrophotometric titrations and CD spectroscopy. The binding constants decreased in the order K (Im)> K (2-MeIm)> K (2- Et-4-MeIm)> K (N-MeIm) for imidazole derivatives, and K (AlaOMe)> K (PheOMe)> K (ValOMe) for amino acid ester derivatives with the same configuration and K-D> K-L for amino acid esters with different configuration. CD spectra can quantify the strength of SalenZn(II)-ligand interactions, giving results consistent with the magnitudes of the binding constants. Moreover the minimum energy conformations of the adducts were obtained by simulated annealing, and quantum chemical calculations were performed based on those conformations to explain experimental results at the molecular level.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 38668-46-1 is helpful to your research. COA of Formula: C9H13N7.